C7H13N3O3S — CID 62374965
N-(2-hydroxyethyl)-N,1-dimethylimidazole-4-sulfonamide (PubChem CID 62374965) has the molecular formula C7H13N3O3S and a molecular weight of 219.27 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N,1-dimethylimidazole-4-sulfonamide.
| Compound Name | N-(2-hydroxyethyl)-N,1-dimethylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 62374965 |
| Molecular Formula | C7H13N3O3S |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | N-(2-hydroxyethyl)-N,1-dimethylimidazole-4-sulfonamide |
| SMILES | CN(CCO)S(=O)(=O)c1cn(C)cn1 |
| InChI | InChI=1S/C7H13N3O3S/c1-9-5-7(8-6-9)14(12,13)10(2)3-4-11/h5-6,11H,3-4H2,1-2H3 |
| InChIKey | CRDVPJSRIJBCBR-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |