C9H16ClN3O3S — CID 55185755
N-(2-chloro-3-methoxypropyl)-N,1-dimethylimidazole-4-sulfonamide (PubChem CID 55185755) has the molecular formula C9H16ClN3O3S and a molecular weight of 281.77 g/mol. Its IUPAC name is N-(2-chloro-3-methoxypropyl)-N,1-dimethylimidazole-4-sulfonamide.
| Compound Name | N-(2-chloro-3-methoxypropyl)-N,1-dimethylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 55185755 |
| Molecular Formula | C9H16ClN3O3S |
| Molecular Weight | 281.77 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | N-(2-chloro-3-methoxypropyl)-N,1-dimethylimidazole-4-sulfonamide |
| SMILES | COCC(Cl)CN(C)S(=O)(=O)c1cn(C)cn1 |
| InChI | InChI=1S/C9H16ClN3O3S/c1-12-5-9(11-7-12)17(14,15)13(2)4-8(10)6-16-3/h5,7-8H,4,6H2,1-3H3 |
| InChIKey | VIQGPBISFVGCCF-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.77 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|