C9H16ClN3O2S — CID 63397074
N-(2-chloropropyl)-N,1,2-trimethylimidazole-4-sulfonamide (PubChem CID 63397074) has the molecular formula C9H16ClN3O2S and a molecular weight of 265.77 g/mol. Its IUPAC name is N-(2-chloropropyl)-N,1,2-trimethylimidazole-4-sulfonamide.
| Compound Name | N-(2-chloropropyl)-N,1,2-trimethylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 63397074 |
| Molecular Formula | C9H16ClN3O2S |
| Molecular Weight | 265.77 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | N-(2-chloropropyl)-N,1,2-trimethylimidazole-4-sulfonamide |
| SMILES | Cc1nc(S(=O)(=O)N(C)CC(C)Cl)cn1C |
| InChI | InChI=1S/C9H16ClN3O2S/c1-7(10)5-13(4)16(14,15)9-6-12(3)8(2)11-9/h6-7H,5H2,1-4H3 |
| InChIKey | DLTLEQNVIREAMD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.77 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|