C14H19N3O3S — CID 62061772
N-[1-(2-hydroxyphenyl)ethyl]-N,1,2-trimethylimidazole-4-sulfonamide (PubChem CID 62061772) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is N-[1-(2-hydroxyphenyl)ethyl]-N,1,2-trimethylimidazole-4-sulfonamide.
| Compound Name | N-[1-(2-hydroxyphenyl)ethyl]-N,1,2-trimethylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 62061772 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-[1-(2-hydroxyphenyl)ethyl]-N,1,2-trimethylimidazole-4-sulfonamide |
| SMILES | Cc1nc(S(=O)(=O)N(C)C(C)c2ccccc2O)cn1C |
| InChI | InChI=1S/C14H19N3O3S/c1-10(12-7-5-6-8-13(12)18)17(4)21(19,20)14-9-16(3)11(2)15-14/h5-10,18H,1-4H3 |
| InChIKey | VJODHKBWJQXSCN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|