C12H19NO5S2 — CID 63242780
N-[1-(2-hydroxyphenyl)ethyl]-N-methyl-2-methylsulfonylethanesulfonamide (PubChem CID 63242780) has the molecular formula C12H19NO5S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-[1-(2-hydroxyphenyl)ethyl]-N-methyl-2-methylsulfonylethanesulfonamide.
| Compound Name | N-[1-(2-hydroxyphenyl)ethyl]-N-methyl-2-methylsulfonylethanesulfonamide |
|---|---|
| PubChem CID | 63242780 |
| Molecular Formula | C12H19NO5S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | N-[1-(2-hydroxyphenyl)ethyl]-N-methyl-2-methylsulfonylethanesulfonamide |
| SMILES | CC(c1ccccc1O)N(C)S(=O)(=O)CCS(C)(=O)=O |
| InChI | InChI=1S/C12H19NO5S2/c1-10(11-6-4-5-7-12(11)14)13(2)20(17,18)9-8-19(3,15)16/h4-7,10,14H,8-9H2,1-3H3 |
| InChIKey | FZPASHXGTSOOFI-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|