C12H19NO4S — CID 107712009
2-[1-[methyl(2-methylsulfonylethyl)amino]ethyl]benzene-1,3-diol (PubChem CID 107712009) has the molecular formula C12H19NO4S and a molecular weight of 273.35 g/mol. Its IUPAC name is 2-[1-[methyl(2-methylsulfonylethyl)amino]ethyl]benzene-1,3-diol.
| Compound Name | 2-[1-[methyl(2-methylsulfonylethyl)amino]ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107712009 |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-[1-[methyl(2-methylsulfonylethyl)amino]ethyl]benzene-1,3-diol |
| SMILES | CC(c1c(O)cccc1O)N(C)CCS(C)(=O)=O |
| InChI | InChI=1S/C12H19NO4S/c1-9(13(2)7-8-18(3,16)17)12-10(14)5-4-6-11(12)15/h4-6,9,14-15H,7-8H2,1-3H3 |
| InChIKey | UWFWJBHRPUFPSG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|