C7H15NO6S2 — CID 63245003
2-[methyl(2-methylsulfonylethylsulfonyl)amino]propanoic acid (PubChem CID 63245003) has the molecular formula C7H15NO6S2 and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-[methyl(2-methylsulfonylethylsulfonyl)amino]propanoic acid.
| Compound Name | 2-[methyl(2-methylsulfonylethylsulfonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 63245003 |
| Molecular Formula | C7H15NO6S2 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 2-[methyl(2-methylsulfonylethylsulfonyl)amino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)S(=O)(=O)CCS(C)(=O)=O |
| InChI | InChI=1S/C7H15NO6S2/c1-6(7(9)10)8(2)16(13,14)5-4-15(3,11)12/h6H,4-5H2,1-3H3,(H,9,10) |
| InChIKey | DAROSBRHFRJSPL-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |