C7H14O6S2 — CID 63666927
2-methyl-3-(2-methylsulfonylethylsulfonyl)propanoic acid (PubChem CID 63666927) has the molecular formula C7H14O6S2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-methyl-3-(2-methylsulfonylethylsulfonyl)propanoic acid.
| Compound Name | 2-methyl-3-(2-methylsulfonylethylsulfonyl)propanoic acid |
|---|---|
| PubChem CID | 63666927 |
| Molecular Formula | C7H14O6S2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 2-methyl-3-(2-methylsulfonylethylsulfonyl)propanoic acid |
| SMILES | CC(CS(=O)(=O)CCS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C7H14O6S2/c1-6(7(8)9)5-15(12,13)4-3-14(2,10)11/h6H,3-5H2,1-2H3,(H,8,9) |
| InChIKey | ZYMBCLQYCVXPDG-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |