C15H22O4S — CID 64914537
3-[(4-tert-butylphenyl)methylsulfonyl]-2-methylpropanoic acid (PubChem CID 64914537) has the molecular formula C15H22O4S and a molecular weight of 298.40 g/mol. Its IUPAC name is 3-[(4-tert-butylphenyl)methylsulfonyl]-2-methylpropanoic acid.
| Compound Name | 3-[(4-tert-butylphenyl)methylsulfonyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 64914537 |
| Molecular Formula | C15H22O4S |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 3-[(4-tert-butylphenyl)methylsulfonyl]-2-methylpropanoic acid |
| SMILES | CC(CS(=O)(=O)Cc1ccc(C(C)(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C15H22O4S/c1-11(14(16)17)9-20(18,19)10-12-5-7-13(8-6-12)15(2,3)4/h5-8,11H,9-10H2,1-4H3,(H,16,17) |
| InChIKey | QAQJPHVLSLOEIY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |