C9H19NO5S — CID 122068997
2-[(2-methoxy-2-methylpropyl)sulfonyl-methylamino]propanoic acid (PubChem CID 122068997) has the molecular formula C9H19NO5S and a molecular weight of 253.32 g/mol. Its IUPAC name is 2-[(2-methoxy-2-methylpropyl)sulfonyl-methylamino]propanoic acid.
| Compound Name | 2-[(2-methoxy-2-methylpropyl)sulfonyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 122068997 |
| Molecular Formula | C9H19NO5S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 2-[(2-methoxy-2-methylpropyl)sulfonyl-methylamino]propanoic acid |
| SMILES | COC(C)(C)CS(=O)(=O)N(C)C(C)C(=O)O |
| InChI | InChI=1S/C9H19NO5S/c1-7(8(11)12)10(4)16(13,14)6-9(2,3)15-5/h7H,6H2,1-5H3,(H,11,12) |
| InChIKey | XIQAMUVTNURTAA-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |