C10H19N3O4S — CID 79373739
1-ethyl-N-(2-hydroxy-3-methoxypropyl)-N-methylimidazole-4-sulfonamide (PubChem CID 79373739) has the molecular formula C10H19N3O4S and a molecular weight of 277.35 g/mol. Its IUPAC name is 1-ethyl-N-(2-hydroxy-3-methoxypropyl)-N-methylimidazole-4-sulfonamide.
| Compound Name | 1-ethyl-N-(2-hydroxy-3-methoxypropyl)-N-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 79373739 |
| Molecular Formula | C10H19N3O4S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 1-ethyl-N-(2-hydroxy-3-methoxypropyl)-N-methylimidazole-4-sulfonamide |
| SMILES | CCn1cnc(S(=O)(=O)N(C)CC(O)COC)c1 |
| InChI | InChI=1S/C10H19N3O4S/c1-4-13-6-10(11-8-13)18(15,16)12(2)5-9(14)7-17-3/h6,8-9,14H,4-5,7H2,1-3H3 |
| InChIKey | DMRYKLQMBFYZHZ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |