C14H19N3O4S — CID 167969086
N-(3,5-dimethoxyphenyl)-1-ethyl-N-methylimidazole-4-sulfonamide (PubChem CID 167969086) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-1-ethyl-N-methylimidazole-4-sulfonamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-1-ethyl-N-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 167969086 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-1-ethyl-N-methylimidazole-4-sulfonamide |
| SMILES | CCn1cnc(S(=O)(=O)N(C)c2cc(OC)cc(OC)c2)c1 |
| InChI | InChI=1S/C14H19N3O4S/c1-5-17-9-14(15-10-17)22(18,19)16(2)11-6-12(20-3)8-13(7-11)21-4/h6-10H,5H2,1-4H3 |
| InChIKey | MXEKJENZQYDKLK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |