C11H13Br2N3 — CID 62379049
2-cyclopropyl-1-(2,6-dibromo-4-methylphenyl)guanidine (PubChem CID 62379049) has the molecular formula C11H13Br2N3 and a molecular weight of 347.05 g/mol. Its IUPAC name is 2-cyclopropyl-1-(2,6-dibromo-4-methylphenyl)guanidine.
| Compound Name | 2-cyclopropyl-1-(2,6-dibromo-4-methylphenyl)guanidine |
|---|---|
| PubChem CID | 62379049 |
| Molecular Formula | C11H13Br2N3 |
| Molecular Weight | 347.05 g/mol |
| Exact Mass | 344.95 |
| IUPAC Name | 2-cyclopropyl-1-(2,6-dibromo-4-methylphenyl)guanidine |
| SMILES | Cc1cc(Br)c(N/C(N)=N/C2CC2)c(Br)c1 |
| InChI | InChI=1S/C11H13Br2N3/c1-6-4-8(12)10(9(13)5-6)16-11(14)15-7-2-3-7/h4-5,7H,2-3H2,1H3,(H3,14,15,16) |
| InChIKey | BELNFLOEXGWRBM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.05 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|