C13H15Cl3O2 — CID 62385711
4-[[2,4-dichloro-6-(chloromethyl)phenoxy]methyl]oxane (PubChem CID 62385711) has the molecular formula C13H15Cl3O2 and a molecular weight of 309.62 g/mol. Its IUPAC name is 4-[[2,4-dichloro-6-(chloromethyl)phenoxy]methyl]oxane.
| Compound Name | 4-[[2,4-dichloro-6-(chloromethyl)phenoxy]methyl]oxane |
|---|---|
| PubChem CID | 62385711 |
| Molecular Formula | C13H15Cl3O2 |
| Molecular Weight | 309.62 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 4-[[2,4-dichloro-6-(chloromethyl)phenoxy]methyl]oxane |
| SMILES | ClCc1cc(Cl)cc(Cl)c1OCC1CCOCC1 |
| InChI | InChI=1S/C13H15Cl3O2/c14-7-10-5-11(15)6-12(16)13(10)18-8-9-1-3-17-4-2-9/h5-6,9H,1-4,7-8H2 |
| InChIKey | HZVPZLYDSSDQAY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.62 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|