C13H15BrCl2O2 — CID 43592015
2-[[2-(bromomethyl)-4,6-dichlorophenoxy]methyl]oxane (PubChem CID 43592015) has the molecular formula C13H15BrCl2O2 and a molecular weight of 354.07 g/mol. Its IUPAC name is 2-[[2-(bromomethyl)-4,6-dichlorophenoxy]methyl]oxane.
| Compound Name | 2-[[2-(bromomethyl)-4,6-dichlorophenoxy]methyl]oxane |
|---|---|
| PubChem CID | 43592015 |
| Molecular Formula | C13H15BrCl2O2 |
| Molecular Weight | 354.07 g/mol |
| Exact Mass | 351.96 |
| IUPAC Name | 2-[[2-(bromomethyl)-4,6-dichlorophenoxy]methyl]oxane |
| SMILES | Clc1cc(Cl)c(OCC2CCCCO2)c(CBr)c1 |
| InChI | InChI=1S/C13H15BrCl2O2/c14-7-9-5-10(15)6-12(16)13(9)18-8-11-3-1-2-4-17-11/h5-6,11H,1-4,7-8H2 |
| InChIKey | YKYIOVROWUKERF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.07 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|