About 2-[(2,3-dimethylphenyl)-hydroxymethyl]-3-methylbutanoic acid
2-[(2,3-dimethylphenyl)-hydroxymethyl]-3-methylbutanoic acid (PubChem CID 62396265) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-[(2,3-dimethylphenyl)-hydroxymethyl]-3-methylbutanoic acid.
Analyze 2-[(2,3-dimethylphenyl)-hydroxymethyl]-3-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,3-dimethylphenyl)-hydroxymethyl]-3-methylbutanoic acid?
The IUPAC name of 2-[(2,3-dimethylphenyl)-hydroxymethyl]-3-methylbutanoic acid (CID 62396265) is 2-[(2,3-dimethylphenyl)-hydroxymethyl]-3-methylbutanoic acid.
What is the SMILES notation for 2-[(2,3-dimethylphenyl)-hydroxymethyl]-3-methylbutanoic acid?
The canonical SMILES for 2-[(2,3-dimethylphenyl)-hydroxymethyl]-3-methylbutanoic acid is Cc1cccc(C(O)C(C(=O)O)C(C)C)c1C.
What is the InChIKey of 2-[(2,3-dimethylphenyl)-hydroxymethyl]-3-methylbutanoic acid?
The InChIKey is STIDWBIWNPHPCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O3/c1-8(2)12(14(16)17)13(15)11-7-5-6-9(3)10(11)4/h5-8,12-13,15H,1-4H3,(H,16,17).
What are the key properties of 2-[(2,3-dimethylphenyl)-hydroxymethyl]-3-methylbutanoic acid?
2-[(2,3-dimethylphenyl)-hydroxymethyl]-3-methylbutanoic acid has a molecular weight of 236.31 g/mol, XLogP of 2.69, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,3-dimethylphenyl)-hydroxymethyl]-3-methylbutanoic acid is sourced from PubChem (CID 62396265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).