C26H34O6 — CID 54403518
(4R,7S)-2,9-bis(2,3-dimethylphenyl)-3,4,7,8-tetrahydroxydecane-5,6-dione (PubChem CID 54403518) has the molecular formula C26H34O6 and a molecular weight of 442.55 g/mol. Its IUPAC name is (4R,7S)-2,9-bis(2,3-dimethylphenyl)-3,4,7,8-tetrahydroxydecane-5,6-dione.
| Compound Name | (4R,7S)-2,9-bis(2,3-dimethylphenyl)-3,4,7,8-tetrahydroxydecane-5,6-dione |
|---|---|
| PubChem CID | 54403518 |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | (4R,7S)-2,9-bis(2,3-dimethylphenyl)-3,4,7,8-tetrahydroxydecane-5,6-dione |
| SMILES | Cc1cccc(C(C)C(O)[C@H](O)C(=O)C(=O)[C@H](O)C(O)C(C)c2cccc(C)c2C)c1C |
| InChI | InChI=1S/C26H34O6/c1-13-9-7-11-19(15(13)3)17(5)21(27)23(29)25(31)26(32)24(30)22(28)18(6)20-12-8-10-14(2)16(20)4/h7-12,17-18,21-24,27-30H,1-6H3/t17?,18?,21?,22?,23-,24+ |
| InChIKey | VPBZVOHJEIXVHO-UPZSSHBASA-N |
| XLogP | 2.41 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|