About (2R)-2-azaniumyl-2-(2,3-dimethylphenyl)acetate
(2R)-2-azaniumyl-2-(2,3-dimethylphenyl)acetate (PubChem CID 7046910) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is (2R)-2-azaniumyl-2-(2,3-dimethylphenyl)acetate.
Molecular Properties
| Compound Name | (2R)-2-azaniumyl-2-(2,3-dimethylphenyl)acetate |
| PubChem CID | 7046910 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (2R)-2-azaniumyl-2-(2,3-dimethylphenyl)acetate |
| SMILES | Cc1cccc([C@@H]([NH3+])C(=O)[O-])c1C |
| InChI | InChI=1S/C10H13NO2/c1-6-4-3-5-8(7(6)2)9(11)10(12)13/h3-5,9H,11H2,1-2H3,(H,12,13)/t9-/m1/s1 |
| InChIKey | FLGHVLZZFJGYOP-SECBINFHSA-N |
| XLogP | -0.66 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-azaniumyl-2-(2,3-dimethylphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-azaniumyl-2-(2,3-dimethylphenyl)acetate?
The IUPAC name of (2R)-2-azaniumyl-2-(2,3-dimethylphenyl)acetate (CID 7046910) is (2R)-2-azaniumyl-2-(2,3-dimethylphenyl)acetate.
What is the SMILES notation for (2R)-2-azaniumyl-2-(2,3-dimethylphenyl)acetate?
The canonical SMILES for (2R)-2-azaniumyl-2-(2,3-dimethylphenyl)acetate is Cc1cccc([C@@H]([NH3+])C(=O)[O-])c1C.
What is the InChIKey of (2R)-2-azaniumyl-2-(2,3-dimethylphenyl)acetate?
The InChIKey is FLGHVLZZFJGYOP-SECBINFHSA-N. The full InChI is InChI=1S/C10H13NO2/c1-6-4-3-5-8(7(6)2)9(11)10(12)13/h3-5,9H,11H2,1-2H3,(H,12,13)/t9-/m1/s1.
What are the key properties of (2R)-2-azaniumyl-2-(2,3-dimethylphenyl)acetate?
(2R)-2-azaniumyl-2-(2,3-dimethylphenyl)acetate has a molecular weight of 179.22 g/mol, XLogP of -0.66, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-azaniumyl-2-(2,3-dimethylphenyl)acetate is sourced from PubChem (CID 7046910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).