3-[(2-methylcyclopropyl)amino]propanoic acid

C7H13NO2 — CID 62398720

IUPAC3-[(2-methylcyclopropyl)amino]propanoic acid
SMILESCC1CC1NCCC(=O)O
InChIInChI=1S/C7H13NO2/c1-5-4-6(5)8-3-2-7(9)10/h5-6,8H,2-4H2,1H3,(H,9,10)
InChIKeyUHGMXWYUSSNPSQ-UHFFFAOYSA-N
MW143.19 g/mol
LogP0.46
Rot. Bonds4

About 3-[(2-methylcyclopropyl)amino]propanoic acid

3-[(2-methylcyclopropyl)amino]propanoic acid (PubChem CID 62398720) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is 3-[(2-methylcyclopropyl)amino]propanoic acid.

Molecular Properties

Compound Name3-[(2-methylcyclopropyl)amino]propanoic acid
PubChem CID62398720
Molecular FormulaC7H13NO2
Molecular Weight143.19 g/mol
Exact Mass143.09
IUPAC Name3-[(2-methylcyclopropyl)amino]propanoic acid
SMILESCC1CC1NCCC(=O)O
InChIInChI=1S/C7H13NO2/c1-5-4-6(5)8-3-2-7(9)10/h5-6,8H,2-4H2,1H3,(H,9,10)
InChIKeyUHGMXWYUSSNPSQ-UHFFFAOYSA-N
XLogP0.46
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500143.19
LogP ≤ 50.46
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-[(2-methylcyclopropyl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-[(2,4,4-trimethylcyclopentyl)amino]propanoic acid
CID 106661765
5-[(2-methylcyclopentyl)amino]pentanoic acid
CID 103251309
4-[(2-methylcyclopropyl)carbamoylamino]-4-oxobutanoic acid
CID 62408428
2-[(3-methoxy-3-oxopropyl)amino]cyclobutane-1-carboxylic acid
CID 103240382
2-hydroxy-2-methyl-3-[(2-methylcyclopropyl)amino]propanoic acid
CID 104644381
4-[(1,3-dimethylpiperidin-4-yl)amino]butanoic acid
CID 114503544
3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propanoic acid
CID 106658180
3-[(3,3,5,5-tetramethylcyclohexyl)amino]propanoic acid
CID 112681935
4-[(2-methylcyclopropanecarbonyl)amino]butanoic acid
CID 16772815
5-[(3,5-dimethylcyclohexyl)amino]pentanoic acid
CID 103254539
N-(2-methoxyethyl)-N'-(2-methylcyclopropyl)ethane-1,2-diamine
CID 79291214
2-(propylamino)cyclobutane-1-carboxylic acid
CID 103235108

Frequently Asked Questions

What is the IUPAC name of 3-[(2-methylcyclopropyl)amino]propanoic acid?
The IUPAC name of 3-[(2-methylcyclopropyl)amino]propanoic acid (CID 62398720) is 3-[(2-methylcyclopropyl)amino]propanoic acid.
What is the SMILES notation for 3-[(2-methylcyclopropyl)amino]propanoic acid?
The canonical SMILES for 3-[(2-methylcyclopropyl)amino]propanoic acid is CC1CC1NCCC(=O)O.
What is the InChIKey of 3-[(2-methylcyclopropyl)amino]propanoic acid?
The InChIKey is UHGMXWYUSSNPSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c1-5-4-6(5)8-3-2-7(9)10/h5-6,8H,2-4H2,1H3,(H,9,10).
What are the key properties of 3-[(2-methylcyclopropyl)amino]propanoic acid?
3-[(2-methylcyclopropyl)amino]propanoic acid has a molecular weight of 143.19 g/mol, XLogP of 0.46, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-methylcyclopropyl)amino]propanoic acid is sourced from PubChem (CID 62398720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).