C12H16N2OS — CID 62401997
N-(2-cyanobutan-2-yl)-4,5-dimethylthiophene-2-carboxamide (PubChem CID 62401997) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is N-(2-cyanobutan-2-yl)-4,5-dimethylthiophene-2-carboxamide.
| Compound Name | N-(2-cyanobutan-2-yl)-4,5-dimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 62401997 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | N-(2-cyanobutan-2-yl)-4,5-dimethylthiophene-2-carboxamide |
| SMILES | CCC(C)(C#N)NC(=O)c1cc(C)c(C)s1 |
| InChI | InChI=1S/C12H16N2OS/c1-5-12(4,7-13)14-11(15)10-6-8(2)9(3)16-10/h6H,5H2,1-4H3,(H,14,15) |
| InChIKey | DVDYEJDDGBAMQW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |