C9H6BrF2N3 — CID 62402108
4-(bromomethyl)-1-(3,5-difluorophenyl)triazole (PubChem CID 62402108) has the molecular formula C9H6BrF2N3 and a molecular weight of 274.07 g/mol. Its IUPAC name is 4-(bromomethyl)-1-(3,5-difluorophenyl)triazole.
| Compound Name | 4-(bromomethyl)-1-(3,5-difluorophenyl)triazole |
|---|---|
| PubChem CID | 62402108 |
| Molecular Formula | C9H6BrF2N3 |
| Molecular Weight | 274.07 g/mol |
| Exact Mass | 272.97 |
| IUPAC Name | 4-(bromomethyl)-1-(3,5-difluorophenyl)triazole |
| SMILES | Fc1cc(F)cc(-n2cc(CBr)nn2)c1 |
| InChI | InChI=1S/C9H6BrF2N3/c10-4-8-5-15(14-13-8)9-2-6(11)1-7(12)3-9/h1-3,5H,4H2 |
| InChIKey | IBUDWXPWFUIBJA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.07 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|