C15H15N5O — CID 62402815
4-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methylamino]benzamide (PubChem CID 62402815) has the molecular formula C15H15N5O and a molecular weight of 281.32 g/mol. Its IUPAC name is 4-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methylamino]benzamide.
| Compound Name | 4-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 62402815 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 4-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methylamino]benzamide |
| SMILES | Cc1cc2ncc(CNc3ccc(C(N)=O)cc3)cn2n1 |
| InChI | InChI=1S/C15H15N5O/c1-10-6-14-18-8-11(9-20(14)19-10)7-17-13-4-2-12(3-5-13)15(16)21/h2-6,8-9,17H,7H2,1H3,(H2,16,21) |
| InChIKey | QNKZLONXGMBETM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |