C17H25F2NO — CID 62406831
2-(1-cyclohexylpropylamino)-1-(2,6-difluorophenyl)ethanol (PubChem CID 62406831) has the molecular formula C17H25F2NO and a molecular weight of 297.39 g/mol. Its IUPAC name is 2-(1-cyclohexylpropylamino)-1-(2,6-difluorophenyl)ethanol.
| Compound Name | 2-(1-cyclohexylpropylamino)-1-(2,6-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 62406831 |
| Molecular Formula | C17H25F2NO |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 2-(1-cyclohexylpropylamino)-1-(2,6-difluorophenyl)ethanol |
| SMILES | CCC(NCC(O)c1c(F)cccc1F)C1CCCCC1 |
| InChI | InChI=1S/C17H25F2NO/c1-2-15(12-7-4-3-5-8-12)20-11-16(21)17-13(18)9-6-10-14(17)19/h6,9-10,12,15-16,20-21H,2-5,7-8,11H2,1H3 |
| InChIKey | ISRYXLRWMBPYPC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |