C10H13F3N2O2S — CID 62407988
2-[1-butan-2-yl-3-(trifluoromethyl)pyrazol-5-yl]sulfanylacetic acid (PubChem CID 62407988) has the molecular formula C10H13F3N2O2S and a molecular weight of 282.29 g/mol. Its IUPAC name is 2-[1-butan-2-yl-3-(trifluoromethyl)pyrazol-5-yl]sulfanylacetic acid.
| Compound Name | 2-[1-butan-2-yl-3-(trifluoromethyl)pyrazol-5-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 62407988 |
| Molecular Formula | C10H13F3N2O2S |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 2-[1-butan-2-yl-3-(trifluoromethyl)pyrazol-5-yl]sulfanylacetic acid |
| SMILES | CCC(C)n1nc(C(F)(F)F)cc1SCC(=O)O |
| InChI | InChI=1S/C10H13F3N2O2S/c1-3-6(2)15-8(18-5-9(16)17)4-7(14-15)10(11,12)13/h4,6H,3,5H2,1-2H3,(H,16,17) |
| InChIKey | CFZJELHPWFQHJB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |