C8H12N4O2S — CID 62408267
2-amino-N-(2-methylcyclopropyl)pyrimidine-5-sulfonamide (PubChem CID 62408267) has the molecular formula C8H12N4O2S and a molecular weight of 228.28 g/mol. Its IUPAC name is 2-amino-N-(2-methylcyclopropyl)pyrimidine-5-sulfonamide.
| Compound Name | 2-amino-N-(2-methylcyclopropyl)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 62408267 |
| Molecular Formula | C8H12N4O2S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 2-amino-N-(2-methylcyclopropyl)pyrimidine-5-sulfonamide |
| SMILES | CC1CC1NS(=O)(=O)c1cnc(N)nc1 |
| InChI | InChI=1S/C8H12N4O2S/c1-5-2-7(5)12-15(13,14)6-3-10-8(9)11-4-6/h3-5,7,12H,2H2,1H3,(H2,9,10,11) |
| InChIKey | SKKWOSNDQXGGRI-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |