C11H13N3S — CID 62409911
2-(2,5-dimethylpyrazol-3-yl)sulfanylaniline (PubChem CID 62409911) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrazol-3-yl)sulfanylaniline.
| Compound Name | 2-(2,5-dimethylpyrazol-3-yl)sulfanylaniline |
|---|---|
| PubChem CID | 62409911 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 2-(2,5-dimethylpyrazol-3-yl)sulfanylaniline |
| SMILES | Cc1cc(Sc2ccccc2N)n(C)n1 |
| InChI | InChI=1S/C11H13N3S/c1-8-7-11(14(2)13-8)15-10-6-4-3-5-9(10)12/h3-7H,12H2,1-2H3 |
| InChIKey | ZLWMVTWRUBAKNI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|