C10H8ClN3OS — CID 62413892
6-chloro-N-(1,3-thiazol-4-ylmethyl)pyridine-2-carboxamide (PubChem CID 62413892) has the molecular formula C10H8ClN3OS and a molecular weight of 253.71 g/mol. Its IUPAC name is 6-chloro-N-(1,3-thiazol-4-ylmethyl)pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-(1,3-thiazol-4-ylmethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62413892 |
| Molecular Formula | C10H8ClN3OS |
| Molecular Weight | 253.71 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 6-chloro-N-(1,3-thiazol-4-ylmethyl)pyridine-2-carboxamide |
| SMILES | O=C(NCc1cscn1)c1cccc(Cl)n1 |
| InChI | InChI=1S/C10H8ClN3OS/c11-9-3-1-2-8(14-9)10(15)12-4-7-5-16-6-13-7/h1-3,5-6H,4H2,(H,12,15) |
| InChIKey | SUOWNQRYJVUCHB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.71 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|