C10H8ClN3OS — CID 81232495
4-chloro-N-(1,3-thiazol-4-ylmethyl)pyridine-3-carboxamide (PubChem CID 81232495) has the molecular formula C10H8ClN3OS and a molecular weight of 253.71 g/mol. Its IUPAC name is 4-chloro-N-(1,3-thiazol-4-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 4-chloro-N-(1,3-thiazol-4-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 81232495 |
| Molecular Formula | C10H8ClN3OS |
| Molecular Weight | 253.71 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 4-chloro-N-(1,3-thiazol-4-ylmethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCc1cscn1)c1cnccc1Cl |
| InChI | InChI=1S/C10H8ClN3OS/c11-9-1-2-12-4-8(9)10(15)13-3-7-5-16-6-14-7/h1-2,4-6H,3H2,(H,13,15) |
| InChIKey | ADXFDNBODGJJOP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.71 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |