C11H8ClN3O3S — CID 49346153
2-chloro-4-nitro-N-(1,3-thiazol-4-ylmethyl)benzamide (PubChem CID 49346153) has the molecular formula C11H8ClN3O3S and a molecular weight of 297.72 g/mol. Its IUPAC name is 2-chloro-4-nitro-N-(1,3-thiazol-4-ylmethyl)benzamide.
| Compound Name | 2-chloro-4-nitro-N-(1,3-thiazol-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 49346153 |
| Molecular Formula | C11H8ClN3O3S |
| Molecular Weight | 297.72 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 2-chloro-4-nitro-N-(1,3-thiazol-4-ylmethyl)benzamide |
| SMILES | O=C(NCc1cscn1)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C11H8ClN3O3S/c12-10-3-8(15(17)18)1-2-9(10)11(16)13-4-7-5-19-6-14-7/h1-3,5-6H,4H2,(H,13,16) |
| InChIKey | RMMLTTIFKZBGIK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.72 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|