C17H23FN2S — CID 62419083
N-[[4-fluoro-2-(methylaminomethyl)-1-benzothiophen-3-yl]methyl]-N-methylcyclopentanamine (PubChem CID 62419083) has the molecular formula C17H23FN2S and a molecular weight of 306.45 g/mol. Its IUPAC name is N-[[4-fluoro-2-(methylaminomethyl)-1-benzothiophen-3-yl]methyl]-N-methylcyclopentanamine.
| Compound Name | N-[[4-fluoro-2-(methylaminomethyl)-1-benzothiophen-3-yl]methyl]-N-methylcyclopentanamine |
|---|---|
| PubChem CID | 62419083 |
| Molecular Formula | C17H23FN2S |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | N-[[4-fluoro-2-(methylaminomethyl)-1-benzothiophen-3-yl]methyl]-N-methylcyclopentanamine |
| SMILES | CNCc1sc2cccc(F)c2c1CN(C)C1CCCC1 |
| InChI | InChI=1S/C17H23FN2S/c1-19-10-16-13(11-20(2)12-6-3-4-7-12)17-14(18)8-5-9-15(17)21-16/h5,8-9,12,19H,3-4,6-7,10-11H2,1-2H3 |
| InChIKey | WQJZHSKIUWGUEU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |