C17H28N2 — CID 62419273
N'-benzyl-N-cyclopropyl-N'-ethylpentane-1,5-diamine (PubChem CID 62419273) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is N'-benzyl-N-cyclopropyl-N'-ethylpentane-1,5-diamine.
| Compound Name | N'-benzyl-N-cyclopropyl-N'-ethylpentane-1,5-diamine |
|---|---|
| PubChem CID | 62419273 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N'-benzyl-N-cyclopropyl-N'-ethylpentane-1,5-diamine |
| SMILES | CCN(CCCCCNC1CC1)Cc1ccccc1 |
| InChI | InChI=1S/C17H28N2/c1-2-19(15-16-9-5-3-6-10-16)14-8-4-7-13-18-17-11-12-17/h3,5-6,9-10,17-18H,2,4,7-8,11-15H2,1H3 |
| InChIKey | PYZHGLNKQQWHMD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|