About 1-N,4-N-dimethyl-4-N-[(5-methylfuran-2-yl)methyl]pentane-1,4-diamine
1-N,4-N-dimethyl-4-N-[(5-methylfuran-2-yl)methyl]pentane-1,4-diamine (PubChem CID 62421162) has the molecular formula C13H24N2O
and a molecular weight of 224.35 g/mol. Its IUPAC name is 1-N,4-N-dimethyl-4-N-[(5-methylfuran-2-yl)methyl]pentane-1,4-diamine.
Molecular Properties
| Compound Name | 1-N,4-N-dimethyl-4-N-[(5-methylfuran-2-yl)methyl]pentane-1,4-diamine |
| PubChem CID | 62421162 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 1-N,4-N-dimethyl-4-N-[(5-methylfuran-2-yl)methyl]pentane-1,4-diamine |
| SMILES | CNCCCC(C)N(C)Cc1ccc(C)o1 |
| InChI | InChI=1S/C13H24N2O/c1-11(6-5-9-14-3)15(4)10-13-8-7-12(2)16-13/h7-8,11,14H,5-6,9-10H2,1-4H3 |
| InChIKey | FNCNBJKRQMYROU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-N,4-N-dimethyl-4-N-[(5-methylfuran-2-yl)methyl]pentane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,4-N-dimethyl-4-N-[(5-methylfuran-2-yl)methyl]pentane-1,4-diamine?
The IUPAC name of 1-N,4-N-dimethyl-4-N-[(5-methylfuran-2-yl)methyl]pentane-1,4-diamine (CID 62421162) is 1-N,4-N-dimethyl-4-N-[(5-methylfuran-2-yl)methyl]pentane-1,4-diamine.
What is the SMILES notation for 1-N,4-N-dimethyl-4-N-[(5-methylfuran-2-yl)methyl]pentane-1,4-diamine?
The canonical SMILES for 1-N,4-N-dimethyl-4-N-[(5-methylfuran-2-yl)methyl]pentane-1,4-diamine is CNCCCC(C)N(C)Cc1ccc(C)o1.
What is the InChIKey of 1-N,4-N-dimethyl-4-N-[(5-methylfuran-2-yl)methyl]pentane-1,4-diamine?
The InChIKey is FNCNBJKRQMYROU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O/c1-11(6-5-9-14-3)15(4)10-13-8-7-12(2)16-13/h7-8,11,14H,5-6,9-10H2,1-4H3.
What are the key properties of 1-N,4-N-dimethyl-4-N-[(5-methylfuran-2-yl)methyl]pentane-1,4-diamine?
1-N,4-N-dimethyl-4-N-[(5-methylfuran-2-yl)methyl]pentane-1,4-diamine has a molecular weight of 224.35 g/mol, XLogP of 2.41, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,4-N-dimethyl-4-N-[(5-methylfuran-2-yl)methyl]pentane-1,4-diamine is sourced from PubChem (CID 62421162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).