C15H26N2 — CID 62462960
1-N,4-N-dimethyl-4-N-[(2-methylphenyl)methyl]pentane-1,4-diamine (PubChem CID 62462960) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 1-N,4-N-dimethyl-4-N-[(2-methylphenyl)methyl]pentane-1,4-diamine.
| Compound Name | 1-N,4-N-dimethyl-4-N-[(2-methylphenyl)methyl]pentane-1,4-diamine |
|---|---|
| PubChem CID | 62462960 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 1-N,4-N-dimethyl-4-N-[(2-methylphenyl)methyl]pentane-1,4-diamine |
| SMILES | CNCCCC(C)N(C)Cc1ccccc1C |
| InChI | InChI=1S/C15H26N2/c1-13-8-5-6-10-15(13)12-17(4)14(2)9-7-11-16-3/h5-6,8,10,14,16H,7,9,11-12H2,1-4H3 |
| InChIKey | XZQORIPJRFAJKU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|