C17H24N2OS — CID 62427917
N-[[5-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]furan-3-yl]methyl]propan-1-amine (PubChem CID 62427917) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is N-[[5-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]furan-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]furan-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62427917 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | N-[[5-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]furan-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1coc(CN2CCc3sccc3C2C)c1 |
| InChI | InChI=1S/C17H24N2OS/c1-3-6-18-10-14-9-15(20-12-14)11-19-7-4-17-16(13(19)2)5-8-21-17/h5,8-9,12-13,18H,3-4,6-7,10-11H2,1-2H3 |
| InChIKey | KAUQHMUPZFKZOH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|