C14H25N3 — CID 62432012
N,2-dimethyl-N'-propyl-N-(pyridin-4-ylmethyl)propane-1,3-diamine (PubChem CID 62432012) has the molecular formula C14H25N3 and a molecular weight of 235.38 g/mol. Its IUPAC name is N,2-dimethyl-N'-propyl-N-(pyridin-4-ylmethyl)propane-1,3-diamine.
| Compound Name | N,2-dimethyl-N'-propyl-N-(pyridin-4-ylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 62432012 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.38 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | N,2-dimethyl-N'-propyl-N-(pyridin-4-ylmethyl)propane-1,3-diamine |
| SMILES | CCCNCC(C)CN(C)Cc1ccncc1 |
| InChI | InChI=1S/C14H25N3/c1-4-7-16-10-13(2)11-17(3)12-14-5-8-15-9-6-14/h5-6,8-9,13,16H,4,7,10-12H2,1-3H3 |
| InChIKey | RQZXPEVMIHHAFK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|