C15H27N3 — CID 62469698
4-[[methyl(2-methylbutyl)amino]methyl]-N-propylpyridin-2-amine (PubChem CID 62469698) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 4-[[methyl(2-methylbutyl)amino]methyl]-N-propylpyridin-2-amine.
| Compound Name | 4-[[methyl(2-methylbutyl)amino]methyl]-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 62469698 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 4-[[methyl(2-methylbutyl)amino]methyl]-N-propylpyridin-2-amine |
| SMILES | CCCNc1cc(CN(C)CC(C)CC)ccn1 |
| InChI | InChI=1S/C15H27N3/c1-5-8-16-15-10-14(7-9-17-15)12-18(4)11-13(3)6-2/h7,9-10,13H,5-6,8,11-12H2,1-4H3,(H,16,17) |
| InChIKey | MHPSBBNEZHLEKC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |