C17H28N2O2 — CID 62435863
N-[[5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylmethyl)furan-3-yl]methyl]-2-methylpropan-2-amine (PubChem CID 62435863) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is N-[[5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylmethyl)furan-3-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylmethyl)furan-3-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 62435863 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | N-[[5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylmethyl)furan-3-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1coc(CN2CCOC3CCCC32)c1 |
| InChI | InChI=1S/C17H28N2O2/c1-17(2,3)18-10-13-9-14(21-12-13)11-19-7-8-20-16-6-4-5-15(16)19/h9,12,15-16,18H,4-8,10-11H2,1-3H3 |
| InChIKey | BVXQFWRUPGWXSY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |