C18H30N2O — CID 65322579
N-[[5-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylmethyl)furan-2-yl]methyl]-2-methylpropan-2-amine (PubChem CID 65322579) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is N-[[5-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylmethyl)furan-2-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[5-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylmethyl)furan-2-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 65322579 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | N-[[5-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylmethyl)furan-2-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1ccc(CN2CCCC3CCCC32)o1 |
| InChI | InChI=1S/C18H30N2O/c1-18(2,3)19-12-15-9-10-16(21-15)13-20-11-5-7-14-6-4-8-17(14)20/h9-10,14,17,19H,4-8,11-13H2,1-3H3 |
| InChIKey | XJFGWVXYBLWDME-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |