C14H29N5O — CID 62435948
N-[[1-[2-[ethyl(2-methoxyethyl)amino]ethyl]triazol-4-yl]methyl]-2-methylpropan-1-amine (PubChem CID 62435948) has the molecular formula C14H29N5O and a molecular weight of 283.42 g/mol. Its IUPAC name is N-[[1-[2-[ethyl(2-methoxyethyl)amino]ethyl]triazol-4-yl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[1-[2-[ethyl(2-methoxyethyl)amino]ethyl]triazol-4-yl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 62435948 |
| Molecular Formula | C14H29N5O |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.24 |
| IUPAC Name | N-[[1-[2-[ethyl(2-methoxyethyl)amino]ethyl]triazol-4-yl]methyl]-2-methylpropan-1-amine |
| SMILES | CCN(CCOC)CCn1cc(CNCC(C)C)nn1 |
| InChI | InChI=1S/C14H29N5O/c1-5-18(8-9-20-4)6-7-19-12-14(16-17-19)11-15-10-13(2)3/h12-13,15H,5-11H2,1-4H3 |
| InChIKey | QLQJUMSHLHVGOK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |