C15H31N5O — CID 63691433
N-[[1-[2-[2-ethoxyethyl(ethyl)amino]ethyl]triazol-4-yl]methyl]-2-methylpropan-1-amine (PubChem CID 63691433) has the molecular formula C15H31N5O and a molecular weight of 297.45 g/mol. Its IUPAC name is N-[[1-[2-[2-ethoxyethyl(ethyl)amino]ethyl]triazol-4-yl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[1-[2-[2-ethoxyethyl(ethyl)amino]ethyl]triazol-4-yl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 63691433 |
| Molecular Formula | C15H31N5O |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | N-[[1-[2-[2-ethoxyethyl(ethyl)amino]ethyl]triazol-4-yl]methyl]-2-methylpropan-1-amine |
| SMILES | CCOCCN(CC)CCn1cc(CNCC(C)C)nn1 |
| InChI | InChI=1S/C15H31N5O/c1-5-19(9-10-21-6-2)7-8-20-13-15(17-18-20)12-16-11-14(3)4/h13-14,16H,5-12H2,1-4H3 |
| InChIKey | HTSRXXILSABDQQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|