About 2-[4-[(2-methylpropylamino)methyl]triazol-1-yl]-N,N-dipropylacetamide
2-[4-[(2-methylpropylamino)methyl]triazol-1-yl]-N,N-dipropylacetamide (PubChem CID 66193073) has the molecular formula C15H29N5O
and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-[4-[(2-methylpropylamino)methyl]triazol-1-yl]-N,N-dipropylacetamide.
Molecular Properties
| Compound Name | 2-[4-[(2-methylpropylamino)methyl]triazol-1-yl]-N,N-dipropylacetamide |
| PubChem CID | 66193073 |
| Molecular Formula | C15H29N5O |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.24 |
| IUPAC Name | 2-[4-[(2-methylpropylamino)methyl]triazol-1-yl]-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)Cn1cc(CNCC(C)C)nn1 |
| InChI | InChI=1S/C15H29N5O/c1-5-7-19(8-6-2)15(21)12-20-11-14(17-18-20)10-16-9-13(3)4/h11,13,16H,5-10,12H2,1-4H3 |
| InChIKey | PYOVMGFGZIKQIC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[(2-methylpropylamino)methyl]triazol-1-yl]-N,N-dipropylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(2-methylpropylamino)methyl]triazol-1-yl]-N,N-dipropylacetamide?
The IUPAC name of 2-[4-[(2-methylpropylamino)methyl]triazol-1-yl]-N,N-dipropylacetamide (CID 66193073) is 2-[4-[(2-methylpropylamino)methyl]triazol-1-yl]-N,N-dipropylacetamide.
What is the SMILES notation for 2-[4-[(2-methylpropylamino)methyl]triazol-1-yl]-N,N-dipropylacetamide?
The canonical SMILES for 2-[4-[(2-methylpropylamino)methyl]triazol-1-yl]-N,N-dipropylacetamide is CCCN(CCC)C(=O)Cn1cc(CNCC(C)C)nn1.
What is the InChIKey of 2-[4-[(2-methylpropylamino)methyl]triazol-1-yl]-N,N-dipropylacetamide?
The InChIKey is PYOVMGFGZIKQIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N5O/c1-5-7-19(8-6-2)15(21)12-20-11-14(17-18-20)10-16-9-13(3)4/h11,13,16H,5-10,12H2,1-4H3.
What are the key properties of 2-[4-[(2-methylpropylamino)methyl]triazol-1-yl]-N,N-dipropylacetamide?
2-[4-[(2-methylpropylamino)methyl]triazol-1-yl]-N,N-dipropylacetamide has a molecular weight of 295.43 g/mol, XLogP of 1.67, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(2-methylpropylamino)methyl]triazol-1-yl]-N,N-dipropylacetamide is sourced from PubChem (CID 66193073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).