C14H14F3NO2 — CID 62441293
N-methyl-1-[5-[[4-(trifluoromethyl)phenoxy]methyl]furan-2-yl]methanamine (PubChem CID 62441293) has the molecular formula C14H14F3NO2 and a molecular weight of 285.27 g/mol. Its IUPAC name is N-methyl-1-[5-[[4-(trifluoromethyl)phenoxy]methyl]furan-2-yl]methanamine.
| Compound Name | N-methyl-1-[5-[[4-(trifluoromethyl)phenoxy]methyl]furan-2-yl]methanamine |
|---|---|
| PubChem CID | 62441293 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | N-methyl-1-[5-[[4-(trifluoromethyl)phenoxy]methyl]furan-2-yl]methanamine |
| SMILES | CNCc1ccc(COc2ccc(C(F)(F)F)cc2)o1 |
| InChI | InChI=1S/C14H14F3NO2/c1-18-8-12-6-7-13(20-12)9-19-11-4-2-10(3-5-11)14(15,16)17/h2-7,18H,8-9H2,1H3 |
| InChIKey | YWJRGJCCYIZMFM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |