C13H13BrFNO2 — CID 81326085
1-[5-[(3-bromo-5-fluorophenoxy)methyl]furan-2-yl]-N-methylmethanamine (PubChem CID 81326085) has the molecular formula C13H13BrFNO2 and a molecular weight of 314.15 g/mol. Its IUPAC name is 1-[5-[(3-bromo-5-fluorophenoxy)methyl]furan-2-yl]-N-methylmethanamine.
| Compound Name | 1-[5-[(3-bromo-5-fluorophenoxy)methyl]furan-2-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 81326085 |
| Molecular Formula | C13H13BrFNO2 |
| Molecular Weight | 314.15 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 1-[5-[(3-bromo-5-fluorophenoxy)methyl]furan-2-yl]-N-methylmethanamine |
| SMILES | CNCc1ccc(COc2cc(F)cc(Br)c2)o1 |
| InChI | InChI=1S/C13H13BrFNO2/c1-16-7-11-2-3-12(18-11)8-17-13-5-9(14)4-10(15)6-13/h2-6,16H,7-8H2,1H3 |
| InChIKey | PKGLHJWXOHCOCQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.15 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |