C12H15F3N4S — CID 62442544
N-[[4-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]-1,3-thiazol-2-yl]methyl]propan-1-amine (PubChem CID 62442544) has the molecular formula C12H15F3N4S and a molecular weight of 304.34 g/mol. Its IUPAC name is N-[[4-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]-1,3-thiazol-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[4-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]-1,3-thiazol-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62442544 |
| Molecular Formula | C12H15F3N4S |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N-[[4-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]-1,3-thiazol-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1nc(Cn2ccc(C(F)(F)F)n2)cs1 |
| InChI | InChI=1S/C12H15F3N4S/c1-2-4-16-6-11-17-9(8-20-11)7-19-5-3-10(18-19)12(13,14)15/h3,5,8,16H,2,4,6-7H2,1H3 |
| InChIKey | SMFJGVJYIITUDH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|