C14H18F3N3O — CID 62442947
N-[[5-methyl-4-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]furan-2-yl]methyl]propan-2-amine (PubChem CID 62442947) has the molecular formula C14H18F3N3O and a molecular weight of 301.31 g/mol. Its IUPAC name is N-[[5-methyl-4-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]furan-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[5-methyl-4-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]furan-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 62442947 |
| Molecular Formula | C14H18F3N3O |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-[[5-methyl-4-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]furan-2-yl]methyl]propan-2-amine |
| SMILES | Cc1oc(CNC(C)C)cc1Cn1ccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H18F3N3O/c1-9(2)18-7-12-6-11(10(3)21-12)8-20-5-4-13(19-20)14(15,16)17/h4-6,9,18H,7-8H2,1-3H3 |
| InChIKey | ITULHFFNSKVYPF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |