C17H23NO2 — CID 62443231
N-[[2-(but-3-enoxymethyl)-1-benzofuran-3-yl]methyl]propan-1-amine (PubChem CID 62443231) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is N-[[2-(but-3-enoxymethyl)-1-benzofuran-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(but-3-enoxymethyl)-1-benzofuran-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62443231 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | N-[[2-(but-3-enoxymethyl)-1-benzofuran-3-yl]methyl]propan-1-amine |
| SMILES | C=CCCOCc1oc2ccccc2c1CNCCC |
| InChI | InChI=1S/C17H23NO2/c1-3-5-11-19-13-17-15(12-18-10-4-2)14-8-6-7-9-16(14)20-17/h3,6-9,18H,1,4-5,10-13H2,2H3 |
| InChIKey | FWWDJWWJTGBZHY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|