C16H20FNO2 — CID 62460473
N-[[2-[(3-fluorophenoxy)methyl]furan-3-yl]methyl]-2-methylpropan-1-amine (PubChem CID 62460473) has the molecular formula C16H20FNO2 and a molecular weight of 277.34 g/mol. Its IUPAC name is N-[[2-[(3-fluorophenoxy)methyl]furan-3-yl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[2-[(3-fluorophenoxy)methyl]furan-3-yl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 62460473 |
| Molecular Formula | C16H20FNO2 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-[[2-[(3-fluorophenoxy)methyl]furan-3-yl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1ccoc1COc1cccc(F)c1 |
| InChI | InChI=1S/C16H20FNO2/c1-12(2)9-18-10-13-6-7-19-16(13)11-20-15-5-3-4-14(17)8-15/h3-8,12,18H,9-11H2,1-2H3 |
| InChIKey | IIBJMNUPJAUPDK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |