C15H19NO4S — CID 62484329
N-[[2-[(3-methylsulfonylphenoxy)methyl]furan-3-yl]methyl]ethanamine (PubChem CID 62484329) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is N-[[2-[(3-methylsulfonylphenoxy)methyl]furan-3-yl]methyl]ethanamine.
| Compound Name | N-[[2-[(3-methylsulfonylphenoxy)methyl]furan-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 62484329 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | N-[[2-[(3-methylsulfonylphenoxy)methyl]furan-3-yl]methyl]ethanamine |
| SMILES | CCNCc1ccoc1COc1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H19NO4S/c1-3-16-10-12-7-8-19-15(12)11-20-13-5-4-6-14(9-13)21(2,17)18/h4-9,16H,3,10-11H2,1-2H3 |
| InChIKey | OTHUKVWCCGTAIM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |