C13H20BrN5S — CID 62462259
N-[(5-bromothiophen-3-yl)methyl]-2-[4-(ethylaminomethyl)triazol-1-yl]-N-methylethanamine (PubChem CID 62462259) has the molecular formula C13H20BrN5S and a molecular weight of 358.31 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-2-[4-(ethylaminomethyl)triazol-1-yl]-N-methylethanamine.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-2-[4-(ethylaminomethyl)triazol-1-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 62462259 |
| Molecular Formula | C13H20BrN5S |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-2-[4-(ethylaminomethyl)triazol-1-yl]-N-methylethanamine |
| SMILES | CCNCc1cn(CCN(C)Cc2csc(Br)c2)nn1 |
| InChI | InChI=1S/C13H20BrN5S/c1-3-15-7-12-9-19(17-16-12)5-4-18(2)8-11-6-13(14)20-10-11/h6,9-10,15H,3-5,7-8H2,1-2H3 |
| InChIKey | YNEJZBNZSMPPMO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |