C13H19FN2O — CID 62462333
N-[[5-(aminomethyl)oxolan-2-yl]methyl]-3-fluoro-N-methylaniline (PubChem CID 62462333) has the molecular formula C13H19FN2O and a molecular weight of 238.31 g/mol. Its IUPAC name is N-[[5-(aminomethyl)oxolan-2-yl]methyl]-3-fluoro-N-methylaniline.
| Compound Name | N-[[5-(aminomethyl)oxolan-2-yl]methyl]-3-fluoro-N-methylaniline |
|---|---|
| PubChem CID | 62462333 |
| Molecular Formula | C13H19FN2O |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | N-[[5-(aminomethyl)oxolan-2-yl]methyl]-3-fluoro-N-methylaniline |
| SMILES | CN(CC1CCC(CN)O1)c1cccc(F)c1 |
| InChI | InChI=1S/C13H19FN2O/c1-16(11-4-2-3-10(14)7-11)9-13-6-5-12(8-15)17-13/h2-4,7,12-13H,5-6,8-9,15H2,1H3 |
| InChIKey | PQVYTLAMXVEBNX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |